C15H13ClN4O4S — CID 54382917
N-(6-chloropyrazin-2-yl)-2,6-dimethyl-1,1,4-trioxo-3H-1λ6,2-benzothiazine-3-carboxamide (PubChem CID 54382917) has the molecular formula C15H13ClN4O4S and a molecular weight of 380.81 g/mol. Its IUPAC name is N-(6-chloropyrazin-2-yl)-2,6-dimethyl-1,1,4-trioxo-3H-1λ6,2-benzothiazine-3-carboxamide.
| Compound Name | N-(6-chloropyrazin-2-yl)-2,6-dimethyl-1,1,4-trioxo-3H-1λ6,2-benzothiazine-3-carboxamide |
|---|---|
| PubChem CID | 54382917 |
| Molecular Formula | C15H13ClN4O4S |
| Molecular Weight | 380.81 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | N-(6-chloropyrazin-2-yl)-2,6-dimethyl-1,1,4-trioxo-3H-1λ6,2-benzothiazine-3-carboxamide |
| SMILES | Cc1ccc2c(c1)C(=O)C(C(=O)Nc1cncc(Cl)n1)N(C)S2(=O)=O |
| InChI | InChI=1S/C15H13ClN4O4S/c1-8-3-4-10-9(5-8)14(21)13(20(2)25(10,23)24)15(22)19-12-7-17-6-11(16)18-12/h3-7,13H,1-2H3,(H,18,19,22) |
| InChIKey | VBFCLFNWMLJKGW-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.81 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|