C11H11NO4S — CID 20608632
5-methyl-1,1-dioxo-2-(2-oxopropyl)-1,2-benzothiazol-3-one (PubChem CID 20608632) has the molecular formula C11H11NO4S and a molecular weight of 253.28 g/mol. Its IUPAC name is 5-methyl-1,1-dioxo-2-(2-oxopropyl)-1,2-benzothiazol-3-one.
| Compound Name | 5-methyl-1,1-dioxo-2-(2-oxopropyl)-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 20608632 |
| Molecular Formula | C11H11NO4S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 5-methyl-1,1-dioxo-2-(2-oxopropyl)-1,2-benzothiazol-3-one |
| SMILES | CC(=O)CN1C(=O)c2cc(C)ccc2S1(=O)=O |
| InChI | InChI=1S/C11H11NO4S/c1-7-3-4-10-9(5-7)11(14)12(6-8(2)13)17(10,15)16/h3-5H,6H2,1-2H3 |
| InChIKey | TZESELNOSFFGFL-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |