C13H18N2O4S — CID 107703741
5-amino-2-(6-hydroxyhexyl)-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 107703741) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is 5-amino-2-(6-hydroxyhexyl)-1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 5-amino-2-(6-hydroxyhexyl)-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 107703741 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 5-amino-2-(6-hydroxyhexyl)-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | Nc1ccc2c(c1)C(=O)N(CCCCCCO)S2(=O)=O |
| InChI | InChI=1S/C13H18N2O4S/c14-10-5-6-12-11(9-10)13(17)15(20(12,18)19)7-3-1-2-4-8-16/h5-6,9,16H,1-4,7-8,14H2 |
| InChIKey | LNUGNXZGRYQMNZ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|