C12H16N2O5S2 — CID 65093276
6-amino-2-(3-ethylsulfonylpropyl)-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 65093276) has the molecular formula C12H16N2O5S2 and a molecular weight of 332.40 g/mol. Its IUPAC name is 6-amino-2-(3-ethylsulfonylpropyl)-1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 6-amino-2-(3-ethylsulfonylpropyl)-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 65093276 |
| Molecular Formula | C12H16N2O5S2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 6-amino-2-(3-ethylsulfonylpropyl)-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | CCS(=O)(=O)CCCN1C(=O)c2ccc(N)cc2S1(=O)=O |
| InChI | InChI=1S/C12H16N2O5S2/c1-2-20(16,17)7-3-6-14-12(15)10-5-4-9(13)8-11(10)21(14,18)19/h4-5,8H,2-3,6-7,13H2,1H3 |
| InChIKey | UIZNCIXYEXHITP-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 114.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|