C10H9F3N2O3S2 — CID 116615847
6-amino-1,1-dioxo-2-[2-(trifluoromethylsulfanyl)ethyl]-1,2-benzothiazol-3-one (PubChem CID 116615847) has the molecular formula C10H9F3N2O3S2 and a molecular weight of 326.32 g/mol. Its IUPAC name is 6-amino-1,1-dioxo-2-[2-(trifluoromethylsulfanyl)ethyl]-1,2-benzothiazol-3-one.
| Compound Name | 6-amino-1,1-dioxo-2-[2-(trifluoromethylsulfanyl)ethyl]-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 116615847 |
| Molecular Formula | C10H9F3N2O3S2 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.00 |
| IUPAC Name | 6-amino-1,1-dioxo-2-[2-(trifluoromethylsulfanyl)ethyl]-1,2-benzothiazol-3-one |
| SMILES | Nc1ccc2c(c1)S(=O)(=O)N(CCSC(F)(F)F)C2=O |
| InChI | InChI=1S/C10H9F3N2O3S2/c11-10(12,13)19-4-3-15-9(16)7-2-1-6(14)5-8(7)20(15,17)18/h1-2,5H,3-4,14H2 |
| InChIKey | IEHMKJRFEMCBDW-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|