C18H12N2O10S2 — CID 3605604
2-[2-(6-carboxy-1,1,3-trioxo-1,2-benzothiazol-2-yl)ethyl]-1,1,3-trioxo-1,2-benzothiazole-6-carboxylic acid (PubChem CID 3605604) has the molecular formula C18H12N2O10S2 and a molecular weight of 480.43 g/mol. Its IUPAC name is 2-[2-(6-carboxy-1,1,3-trioxo-1,2-benzothiazol-2-yl)ethyl]-1,1,3-trioxo-1,2-benzothiazole-6-carboxylic acid.
| Compound Name | 2-[2-(6-carboxy-1,1,3-trioxo-1,2-benzothiazol-2-yl)ethyl]-1,1,3-trioxo-1,2-benzothiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 3605604 |
| Molecular Formula | C18H12N2O10S2 |
| Molecular Weight | 480.43 g/mol |
| Exact Mass | 479.99 |
| IUPAC Name | 2-[2-(6-carboxy-1,1,3-trioxo-1,2-benzothiazol-2-yl)ethyl]-1,1,3-trioxo-1,2-benzothiazole-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)S(=O)(=O)N(CCN1C(=O)c3ccc(C(=O)O)cc3S1(=O)=O)C2=O |
| InChI | InChI=1S/C18H12N2O10S2/c21-15-11-3-1-9(17(23)24)7-13(11)31(27,28)19(15)5-6-20-16(22)12-4-2-10(18(25)26)8-14(12)32(20,29)30/h1-4,7-8H,5-6H2,(H,23,24)(H,25,26) |
| InChIKey | KYYKGEMTZCZDNT-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 183.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.43 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |