C13H14N2O5S — CID 91206594
4-methyl-2-(2-methylprop-2-enyl)-1,1,3-trioxo-1λ6,2,4-benzothiadiazine-7-carboxylic acid (PubChem CID 91206594) has the molecular formula C13H14N2O5S and a molecular weight of 310.33 g/mol. Its IUPAC name is 4-methyl-2-(2-methylprop-2-enyl)-1,1,3-trioxo-1λ6,2,4-benzothiadiazine-7-carboxylic acid.
| Compound Name | 4-methyl-2-(2-methylprop-2-enyl)-1,1,3-trioxo-1λ6,2,4-benzothiadiazine-7-carboxylic acid |
|---|---|
| PubChem CID | 91206594 |
| Molecular Formula | C13H14N2O5S |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 4-methyl-2-(2-methylprop-2-enyl)-1,1,3-trioxo-1λ6,2,4-benzothiadiazine-7-carboxylic acid |
| SMILES | C=C(C)CN1C(=O)N(C)c2ccc(C(=O)O)cc2S1(=O)=O |
| InChI | InChI=1S/C13H14N2O5S/c1-8(2)7-15-13(18)14(3)10-5-4-9(12(16)17)6-11(10)21(15,19)20/h4-6H,1,7H2,2-3H3,(H,16,17) |
| InChIKey | DAEZGAVNWZLZMT-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|