C24H22N4O7S — CID 10185868
N-[(4-methoxyphenyl)methyl]-4-methyl-2-[(4-nitrophenyl)methyl]-1,1,3-trioxo-1λ6,2,4-benzothiadiazine-7-carboxamide (PubChem CID 10185868) has the molecular formula C24H22N4O7S and a molecular weight of 510.53 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-4-methyl-2-[(4-nitrophenyl)methyl]-1,1,3-trioxo-1λ6,2,4-benzothiadiazine-7-carboxamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-4-methyl-2-[(4-nitrophenyl)methyl]-1,1,3-trioxo-1λ6,2,4-benzothiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 10185868 |
| Molecular Formula | C24H22N4O7S |
| Molecular Weight | 510.53 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-4-methyl-2-[(4-nitrophenyl)methyl]-1,1,3-trioxo-1λ6,2,4-benzothiadiazine-7-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2ccc3c(c2)S(=O)(=O)N(Cc2ccc([N+](=O)[O-])cc2)C(=O)N3C)cc1 |
| InChI | InChI=1S/C24H22N4O7S/c1-26-21-12-7-18(23(29)25-14-16-5-10-20(35-2)11-6-16)13-22(21)36(33,34)27(24(26)30)15-17-3-8-19(9-4-17)28(31)32/h3-13H,14-15H2,1-2H3,(H,25,29) |
| InChIKey | WDAYTKNRLFKESC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.53 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|