C15H11N3O7S — CID 122186716
N-hydroxy-4-[(6-nitro-1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl]benzamide (PubChem CID 122186716) has the molecular formula C15H11N3O7S and a molecular weight of 377.33 g/mol. Its IUPAC name is N-hydroxy-4-[(6-nitro-1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl]benzamide.
| Compound Name | N-hydroxy-4-[(6-nitro-1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 122186716 |
| Molecular Formula | C15H11N3O7S |
| Molecular Weight | 377.33 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | N-hydroxy-4-[(6-nitro-1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl]benzamide |
| SMILES | O=C(NO)c1ccc(CN2C(=O)c3ccc([N+](=O)[O-])cc3S2(=O)=O)cc1 |
| InChI | InChI=1S/C15H11N3O7S/c19-14(16-21)10-3-1-9(2-4-10)8-17-15(20)12-6-5-11(18(22)23)7-13(12)26(17,24)25/h1-7,21H,8H2,(H,16,19) |
| InChIKey | HGBJXMADCVCXHN-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 146.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.33 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|