C10H9N3O7S — CID 65443021
2-amino-3-(6-nitro-1,1,3-trioxo-1,2-benzothiazol-2-yl)propanoic acid (PubChem CID 65443021) has the molecular formula C10H9N3O7S and a molecular weight of 315.26 g/mol. Its IUPAC name is 2-amino-3-(6-nitro-1,1,3-trioxo-1,2-benzothiazol-2-yl)propanoic acid.
| Compound Name | 2-amino-3-(6-nitro-1,1,3-trioxo-1,2-benzothiazol-2-yl)propanoic acid |
|---|---|
| PubChem CID | 65443021 |
| Molecular Formula | C10H9N3O7S |
| Molecular Weight | 315.26 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | 2-amino-3-(6-nitro-1,1,3-trioxo-1,2-benzothiazol-2-yl)propanoic acid |
| SMILES | NC(CN1C(=O)c2ccc([N+](=O)[O-])cc2S1(=O)=O)C(=O)O |
| InChI | InChI=1S/C10H9N3O7S/c11-7(10(15)16)4-12-9(14)6-2-1-5(13(17)18)3-8(6)21(12,19)20/h1-3,7H,4,11H2,(H,15,16) |
| InChIKey | MAYBKCXQFOGEPK-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 160.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.26 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|