C13H8N2O5S — CID 627605
6-nitro-1,1-dioxo-2-phenyl-1,2-benzothiazol-3-one (PubChem CID 627605) has the molecular formula C13H8N2O5S and a molecular weight of 304.28 g/mol. Its IUPAC name is 6-nitro-1,1-dioxo-2-phenyl-1,2-benzothiazol-3-one.
| Compound Name | 6-nitro-1,1-dioxo-2-phenyl-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 627605 |
| Molecular Formula | C13H8N2O5S |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 6-nitro-1,1-dioxo-2-phenyl-1,2-benzothiazol-3-one |
| SMILES | O=C1c2ccc([N+](=O)[O-])cc2S(=O)(=O)N1c1ccccc1 |
| InChI | InChI=1S/C13H8N2O5S/c16-13-11-7-6-10(15(17)18)8-12(11)21(19,20)14(13)9-4-2-1-3-5-9/h1-8H |
| InChIKey | FASUMANJBDEXRK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|