C20H14ClN3O5S — CID 2138494
2-(4-chlorophenyl)-4-[(3-nitrophenyl)methyl]-1,1-dioxo-1lambda6,2,4-benzothiadiazin-3-one (PubChem CID 2138494) has the molecular formula C20H14ClN3O5S and a molecular weight of 443.87 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-[(3-nitrophenyl)methyl]-1,1-dioxo-1lambda6,2,4-benzothiadiazin-3-one.
| Compound Name | 2-(4-chlorophenyl)-4-[(3-nitrophenyl)methyl]-1,1-dioxo-1lambda6,2,4-benzothiadiazin-3-one |
|---|---|
| PubChem CID | 2138494 |
| Molecular Formula | C20H14ClN3O5S |
| Molecular Weight | 443.87 g/mol |
| Exact Mass | 443.03 |
| IUPAC Name | 2-(4-chlorophenyl)-4-[(3-nitrophenyl)methyl]-1,1-dioxo-1lambda6,2,4-benzothiadiazin-3-one |
| SMILES | O=C1N(Cc2cccc([N+](=O)[O-])c2)c2ccccc2S(=O)(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H14ClN3O5S/c21-15-8-10-16(11-9-15)23-20(25)22(13-14-4-3-5-17(12-14)24(26)27)18-6-1-2-7-19(18)30(23,28)29/h1-12H,13H2 |
| InChIKey | BYAOIQQRMKWZTP-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.87 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|