C12H12N2O6S — CID 64867161
5-nitro-1,1-dioxo-2-(3-oxopentan-2-yl)-1,2-benzothiazol-3-one (PubChem CID 64867161) has the molecular formula C12H12N2O6S and a molecular weight of 312.30 g/mol. Its IUPAC name is 5-nitro-1,1-dioxo-2-(3-oxopentan-2-yl)-1,2-benzothiazol-3-one.
| Compound Name | 5-nitro-1,1-dioxo-2-(3-oxopentan-2-yl)-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 64867161 |
| Molecular Formula | C12H12N2O6S |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 5-nitro-1,1-dioxo-2-(3-oxopentan-2-yl)-1,2-benzothiazol-3-one |
| SMILES | CCC(=O)C(C)N1C(=O)c2cc([N+](=O)[O-])ccc2S1(=O)=O |
| InChI | InChI=1S/C12H12N2O6S/c1-3-10(15)7(2)13-12(16)9-6-8(14(17)18)4-5-11(9)21(13,19)20/h4-7H,3H2,1-2H3 |
| InChIKey | NQJCSHTWPUNBOV-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 114.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|