C11H7N2NaO6 — CID 24940940
sodium 2-(5-nitro-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 24940940) has the molecular formula C11H7N2NaO6 and a molecular weight of 286.18 g/mol. Its IUPAC name is sodium 2-(5-nitro-1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | sodium 2-(5-nitro-1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 24940940 |
| Molecular Formula | C11H7N2NaO6 |
| Molecular Weight | 286.18 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | sodium 2-(5-nitro-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | CC(C(=O)[O-])N1C(=O)c2ccc([N+](=O)[O-])cc2C1=O.[Na+] |
| InChI | InChI=1S/C11H8N2O6.Na/c1-5(11(16)17)12-9(14)7-3-2-6(13(18)19)4-8(7)10(12)15;/h2-5H,1H3,(H,16,17);/q;+1/p-1 |
| InChIKey | OCGZNENDLYBHRD-UHFFFAOYSA-M |
| XLogP | -3.67 |
| TPSA | 120.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.18 |
| LogP ≤ 5 | -3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|