C15H9N3O8 — CID 3604979
2-(5,8-dinitro-1,3-dioxobenzo[de]isoquinolin-2-yl)propanoic acid (PubChem CID 3604979) has the molecular formula C15H9N3O8 and a molecular weight of 359.25 g/mol. Its IUPAC name is 2-(5,8-dinitro-1,3-dioxobenzo[de]isoquinolin-2-yl)propanoic acid.
| Compound Name | 2-(5,8-dinitro-1,3-dioxobenzo[de]isoquinolin-2-yl)propanoic acid |
|---|---|
| PubChem CID | 3604979 |
| Molecular Formula | C15H9N3O8 |
| Molecular Weight | 359.25 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | 2-(5,8-dinitro-1,3-dioxobenzo[de]isoquinolin-2-yl)propanoic acid |
| SMILES | CC(C(=O)O)N1C(=O)c2cc([N+](=O)[O-])cc3cc([N+](=O)[O-])cc(c23)C1=O |
| InChI | InChI=1S/C15H9N3O8/c1-6(15(21)22)16-13(19)10-4-8(17(23)24)2-7-3-9(18(25)26)5-11(12(7)10)14(16)20/h2-6H,1H3,(H,21,22) |
| InChIKey | ZOJJLYPUPRRRRG-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 160.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|