C20H11N3O7 — CID 4668019
2-(4-acetylphenyl)-5,8-dinitrobenzo[de]isoquinoline-1,3-dione (PubChem CID 4668019) has the molecular formula C20H11N3O7 and a molecular weight of 405.32 g/mol. Its IUPAC name is 2-(4-acetylphenyl)-5,8-dinitrobenzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-(4-acetylphenyl)-5,8-dinitrobenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 4668019 |
| Molecular Formula | C20H11N3O7 |
| Molecular Weight | 405.32 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | 2-(4-acetylphenyl)-5,8-dinitrobenzo[de]isoquinoline-1,3-dione |
| SMILES | CC(=O)c1ccc(N2C(=O)c3cc([N+](=O)[O-])cc4cc([N+](=O)[O-])cc(c34)C2=O)cc1 |
| InChI | InChI=1S/C20H11N3O7/c1-10(24)11-2-4-13(5-3-11)21-19(25)16-8-14(22(27)28)6-12-7-15(23(29)30)9-17(18(12)16)20(21)26/h2-9H,1H3 |
| InChIKey | FLHGSXUSPVLZGP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.32 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|