C31H18N2O8 — CID 89262684
[2-[4-(cyclopenta-1,3-diene-1-carbonyloxy)phenyl]-1,3-dioxobenzo[de]isoquinolin-5-yl] 4-nitrobenzoate (PubChem CID 89262684) has the molecular formula C31H18N2O8 and a molecular weight of 546.49 g/mol. Its IUPAC name is [2-[4-(cyclopenta-1,3-diene-1-carbonyloxy)phenyl]-1,3-dioxobenzo[de]isoquinolin-5-yl] 4-nitrobenzoate.
| Compound Name | [2-[4-(cyclopenta-1,3-diene-1-carbonyloxy)phenyl]-1,3-dioxobenzo[de]isoquinolin-5-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 89262684 |
| Molecular Formula | C31H18N2O8 |
| Molecular Weight | 546.49 g/mol |
| Exact Mass | 546.11 |
| IUPAC Name | [2-[4-(cyclopenta-1,3-diene-1-carbonyloxy)phenyl]-1,3-dioxobenzo[de]isoquinolin-5-yl] 4-nitrobenzoate |
| SMILES | O=C(Oc1ccc(N2C(=O)c3cccc4cc(OC(=O)c5ccc([N+](=O)[O-])cc5)cc(c34)C2=O)cc1)C1=CC=CC1 |
| InChI | InChI=1S/C31H18N2O8/c34-28-25-7-3-6-20-16-24(41-31(37)19-8-10-22(11-9-19)33(38)39)17-26(27(20)25)29(35)32(28)21-12-14-23(15-13-21)40-30(36)18-4-1-2-5-18/h1-4,6-17H,5H2 |
| InChIKey | SFEPUQWPXLNIML-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 133.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.49 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|