C31H22N2O8 — CID 59005428
[2-[4-(cyclopentanecarbonyloxy)phenyl]-1,3-dioxobenzo[de]isoquinolin-5-yl] 4-nitrobenzoate (PubChem CID 59005428) has the molecular formula C31H22N2O8 and a molecular weight of 550.52 g/mol. Its IUPAC name is [2-[4-(cyclopentanecarbonyloxy)phenyl]-1,3-dioxobenzo[de]isoquinolin-5-yl] 4-nitrobenzoate.
| Compound Name | [2-[4-(cyclopentanecarbonyloxy)phenyl]-1,3-dioxobenzo[de]isoquinolin-5-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 59005428 |
| Molecular Formula | C31H22N2O8 |
| Molecular Weight | 550.52 g/mol |
| Exact Mass | 550.14 |
| IUPAC Name | [2-[4-(cyclopentanecarbonyloxy)phenyl]-1,3-dioxobenzo[de]isoquinolin-5-yl] 4-nitrobenzoate |
| SMILES | O=C(Oc1cc2c3c(cccc3c1)C(=O)N(c1ccc(OC(=O)C3CCCC3)cc1)C2=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C31H22N2O8/c34-28-25-7-3-6-20-16-24(41-31(37)19-8-10-22(11-9-19)33(38)39)17-26(27(20)25)29(35)32(28)21-12-14-23(15-13-21)40-30(36)18-4-1-2-5-18/h3,6-18H,1-2,4-5H2 |
| InChIKey | LIJLAIQDILGCNT-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 133.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.52 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|