C30H19NO5 — CID 89262729
[4-(1,3-dioxo-5-phenoxybenzo[de]isoquinolin-2-yl)phenyl] cyclopenta-1,3-diene-1-carboxylate (PubChem CID 89262729) has the molecular formula C30H19NO5 and a molecular weight of 473.48 g/mol. Its IUPAC name is [4-(1,3-dioxo-5-phenoxybenzo[de]isoquinolin-2-yl)phenyl] cyclopenta-1,3-diene-1-carboxylate.
| Compound Name | [4-(1,3-dioxo-5-phenoxybenzo[de]isoquinolin-2-yl)phenyl] cyclopenta-1,3-diene-1-carboxylate |
|---|---|
| PubChem CID | 89262729 |
| Molecular Formula | C30H19NO5 |
| Molecular Weight | 473.48 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | [4-(1,3-dioxo-5-phenoxybenzo[de]isoquinolin-2-yl)phenyl] cyclopenta-1,3-diene-1-carboxylate |
| SMILES | O=C(Oc1ccc(N2C(=O)c3cccc4cc(Oc5ccccc5)cc(c34)C2=O)cc1)C1=CC=CC1 |
| InChI | InChI=1S/C30H19NO5/c32-28-25-12-6-9-20-17-24(35-22-10-2-1-3-11-22)18-26(27(20)25)29(33)31(28)21-13-15-23(16-14-21)36-30(34)19-7-4-5-8-19/h1-7,9-18H,8H2 |
| InChIKey | DCCDYVRBTFCXAH-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.48 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|