C27H25NO7 — CID 19181569
[4-(1,3-dioxoisoindol-2-yl)phenyl] 3,4,5-triethoxybenzoate (PubChem CID 19181569) has the molecular formula C27H25NO7 and a molecular weight of 475.50 g/mol. Its IUPAC name is [4-(1,3-dioxoisoindol-2-yl)phenyl] 3,4,5-triethoxybenzoate.
| Compound Name | [4-(1,3-dioxoisoindol-2-yl)phenyl] 3,4,5-triethoxybenzoate |
|---|---|
| PubChem CID | 19181569 |
| Molecular Formula | C27H25NO7 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | [4-(1,3-dioxoisoindol-2-yl)phenyl] 3,4,5-triethoxybenzoate |
| SMILES | CCOc1cc(C(=O)Oc2ccc(N3C(=O)c4ccccc4C3=O)cc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C27H25NO7/c1-4-32-22-15-17(16-23(33-5-2)24(22)34-6-3)27(31)35-19-13-11-18(12-14-19)28-25(29)20-9-7-8-10-21(20)26(28)30/h7-16H,4-6H2,1-3H3 |
| InChIKey | VCFCQKFPITUTOR-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|