C22H15NO4 — CID 1217603
(2-methylphenyl) 4-(1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 1217603) has the molecular formula C22H15NO4 and a molecular weight of 357.37 g/mol. Its IUPAC name is (2-methylphenyl) 4-(1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | (2-methylphenyl) 4-(1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 1217603 |
| Molecular Formula | C22H15NO4 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | (2-methylphenyl) 4-(1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | Cc1ccccc1OC(=O)c1ccc(N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C22H15NO4/c1-14-6-2-5-9-19(14)27-22(26)15-10-12-16(13-11-15)23-20(24)17-7-3-4-8-18(17)21(23)25/h2-13H,1H3 |
| InChIKey | DLQJTACHKYCWKY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|