C28H18N2O5 — CID 1396395
[2-(phenylcarbamoyl)phenyl] 4-(1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 1396395) has the molecular formula C28H18N2O5 and a molecular weight of 462.46 g/mol. Its IUPAC name is [2-(phenylcarbamoyl)phenyl] 4-(1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | [2-(phenylcarbamoyl)phenyl] 4-(1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 1396395 |
| Molecular Formula | C28H18N2O5 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | [2-(phenylcarbamoyl)phenyl] 4-(1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | O=C(Oc1ccccc1C(=O)Nc1ccccc1)c1ccc(N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C28H18N2O5/c31-25(29-19-8-2-1-3-9-19)23-12-6-7-13-24(23)35-28(34)18-14-16-20(17-15-18)30-26(32)21-10-4-5-11-22(21)27(30)33/h1-17H,(H,29,31) |
| InChIKey | OYJMNCRVFPJYNF-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|