C21H12BrNO4 — CID 1217607
(4-bromophenyl) 3-(1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 1217607) has the molecular formula C21H12BrNO4 and a molecular weight of 422.23 g/mol. Its IUPAC name is (4-bromophenyl) 3-(1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | (4-bromophenyl) 3-(1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 1217607 |
| Molecular Formula | C21H12BrNO4 |
| Molecular Weight | 422.23 g/mol |
| Exact Mass | 420.99 |
| IUPAC Name | (4-bromophenyl) 3-(1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | O=C(Oc1ccc(Br)cc1)c1cccc(N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C21H12BrNO4/c22-14-8-10-16(11-9-14)27-21(26)13-4-3-5-15(12-13)23-19(24)17-6-1-2-7-18(17)20(23)25/h1-12H |
| InChIKey | GPCNNXFBJAGBAR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.23 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|