C26H23NO4 — CID 19177523
(2-tert-butyl-4-methylphenyl) 3-(1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 19177523) has the molecular formula C26H23NO4 and a molecular weight of 413.47 g/mol. Its IUPAC name is (2-tert-butyl-4-methylphenyl) 3-(1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | (2-tert-butyl-4-methylphenyl) 3-(1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 19177523 |
| Molecular Formula | C26H23NO4 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | (2-tert-butyl-4-methylphenyl) 3-(1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | Cc1ccc(OC(=O)c2cccc(N3C(=O)c4ccccc4C3=O)c2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C26H23NO4/c1-16-12-13-22(21(14-16)26(2,3)4)31-25(30)17-8-7-9-18(15-17)27-23(28)19-10-5-6-11-20(19)24(27)29/h5-15H,1-4H3 |
| InChIKey | QAHYUTDLFHYYAA-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|