C22H14INO4 — CID 126224259
(4-iodophenyl)methyl 3-(1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 126224259) has the molecular formula C22H14INO4 and a molecular weight of 483.26 g/mol. Its IUPAC name is (4-iodophenyl)methyl 3-(1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | (4-iodophenyl)methyl 3-(1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 126224259 |
| Molecular Formula | C22H14INO4 |
| Molecular Weight | 483.26 g/mol |
| Exact Mass | 483.00 |
| IUPAC Name | (4-iodophenyl)methyl 3-(1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | O=C(OCc1ccc(I)cc1)c1cccc(N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C22H14INO4/c23-16-10-8-14(9-11-16)13-28-22(27)15-4-3-5-17(12-15)24-20(25)18-6-1-2-7-19(18)21(24)26/h1-12H,13H2 |
| InChIKey | CNCBAVBLARTZJA-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.26 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|