C24H24N2O5 — CID 2540577
[2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl] 3-(1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 2540577) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is [2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl] 3-(1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | [2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl] 3-(1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 2540577 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | [2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl] 3-(1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | C[C@@H]1CCC[C@H](C)N1C(=O)COC(=O)c1cccc(N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C24H24N2O5/c1-15-7-5-8-16(2)25(15)21(27)14-31-24(30)17-9-6-10-18(13-17)26-22(28)19-11-3-4-12-20(19)23(26)29/h3-4,6,9-13,15-16H,5,7-8,14H2,1-2H3/t15-,16+ |
| InChIKey | WCGVHGAIOIRAML-IYBDPMFKSA-N |
| XLogP | 3.43 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|