C22H28N2O5 — CID 7533867
[2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl] (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate (PubChem CID 7533867) has the molecular formula C22H28N2O5 and a molecular weight of 400.48 g/mol. Its IUPAC name is [2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl] (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate.
| Compound Name | [2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl] (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate |
|---|---|
| PubChem CID | 7533867 |
| Molecular Formula | C22H28N2O5 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | [2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl] (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate |
| SMILES | CC(C)[C@@H](C(=O)OCC(=O)N1[C@H](C)CCC[C@@H]1C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H28N2O5/c1-13(2)19(24-20(26)16-10-5-6-11-17(16)21(24)27)22(28)29-12-18(25)23-14(3)8-7-9-15(23)4/h5-6,10-11,13-15,19H,7-9,12H2,1-4H3/t14-,15+,19-/m0/s1 |
| InChIKey | OZYYYDCHNUCLQK-KHYOSLBOSA-N |
| XLogP | 2.64 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|