C19H21NO5 — CID 7533815
[(1R)-2-oxocyclohexyl] (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate (PubChem CID 7533815) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is [(1R)-2-oxocyclohexyl] (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate.
| Compound Name | [(1R)-2-oxocyclohexyl] (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate |
|---|---|
| PubChem CID | 7533815 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | [(1R)-2-oxocyclohexyl] (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate |
| SMILES | CC(C)[C@@H](C(=O)O[C@@H]1CCCCC1=O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H21NO5/c1-11(2)16(19(24)25-15-10-6-5-9-14(15)21)20-17(22)12-7-3-4-8-13(12)18(20)23/h3-4,7-8,11,15-16H,5-6,9-10H2,1-2H3/t15-,16+/m1/s1 |
| InChIKey | GGJWNWKFHMIYII-CVEARBPZSA-N |
| XLogP | 2.36 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|