C16H18N2O5S — CID 135702579
[(1S)-2-oxocyclohexyl] (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate (PubChem CID 135702579) has the molecular formula C16H18N2O5S and a molecular weight of 350.40 g/mol. Its IUPAC name is [(1S)-2-oxocyclohexyl] (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate.
| Compound Name | [(1S)-2-oxocyclohexyl] (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
|---|---|
| PubChem CID | 135702579 |
| Molecular Formula | C16H18N2O5S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | [(1S)-2-oxocyclohexyl] (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
| SMILES | C[C@H](/N=C1\NS(=O)(=O)c2ccccc21)C(=O)O[C@H]1CCCCC1=O |
| InChI | InChI=1S/C16H18N2O5S/c1-10(16(20)23-13-8-4-3-7-12(13)19)17-15-11-6-2-5-9-14(11)24(21,22)18-15/h2,5-6,9-10,13H,3-4,7-8H2,1H3,(H,17,18)/t10-,13-/m0/s1 |
| InChIKey | LQNJNUMLZXPBPQ-GWCFXTLKSA-N |
| XLogP | 1.17 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|