C19H24N2O5S — CID 135949698
[(1S)-2-oxocyclohexyl] 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoate (PubChem CID 135949698) has the molecular formula C19H24N2O5S and a molecular weight of 392.48 g/mol. Its IUPAC name is [(1S)-2-oxocyclohexyl] 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoate.
| Compound Name | [(1S)-2-oxocyclohexyl] 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoate |
|---|---|
| PubChem CID | 135949698 |
| Molecular Formula | C19H24N2O5S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | [(1S)-2-oxocyclohexyl] 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoate |
| SMILES | O=C(CCCCC/N=C1\NS(=O)(=O)c2ccccc21)O[C@H]1CCCCC1=O |
| InChI | InChI=1S/C19H24N2O5S/c22-15-9-4-5-10-16(15)26-18(23)12-2-1-7-13-20-19-14-8-3-6-11-17(14)27(24,25)21-19/h3,6,8,11,16H,1-2,4-5,7,9-10,12-13H2,(H,20,21)/t16-/m0/s1 |
| InChIKey | KDRVGFROOBVZID-INIZCTEOSA-N |
| XLogP | 2.34 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|