C21H23FN2O5S — CID 135925635
2-(2-fluorophenoxy)ethyl 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoate (PubChem CID 135925635) has the molecular formula C21H23FN2O5S and a molecular weight of 434.49 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)ethyl 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoate.
| Compound Name | 2-(2-fluorophenoxy)ethyl 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoate |
|---|---|
| PubChem CID | 135925635 |
| Molecular Formula | C21H23FN2O5S |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 2-(2-fluorophenoxy)ethyl 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoate |
| SMILES | O=C(CCCCC/N=C1\NS(=O)(=O)c2ccccc21)OCCOc1ccccc1F |
| InChI | InChI=1S/C21H23FN2O5S/c22-17-9-4-5-10-18(17)28-14-15-29-20(25)12-2-1-7-13-23-21-16-8-3-6-11-19(16)30(26,27)24-21/h3-6,8-11H,1-2,7,12-15H2,(H,23,24) |
| InChIKey | BYPMLXQKTGEUHP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|