C19H15N3O6S — CID 135714227
(1,3-dioxoisoindol-2-yl)methyl 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate (PubChem CID 135714227) has the molecular formula C19H15N3O6S and a molecular weight of 413.41 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
|---|---|
| PubChem CID | 135714227 |
| Molecular Formula | C19H15N3O6S |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
| SMILES | O=C(CC/N=C1\NS(=O)(=O)c2ccccc21)OCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H15N3O6S/c23-16(28-11-22-18(24)12-5-1-2-6-13(12)19(22)25)9-10-20-17-14-7-3-4-8-15(14)29(26,27)21-17/h1-8H,9-11H2,(H,20,21) |
| InChIKey | ZRGUFHCIKOLECN-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 122.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|