C18H15ClN4O4S — CID 135802889
(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate (PubChem CID 135802889) has the molecular formula C18H15ClN4O4S and a molecular weight of 418.86 g/mol. Its IUPAC name is (6-chloroimidazo[1,2-a]pyridin-2-yl)methyl 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate.
| Compound Name | (6-chloroimidazo[1,2-a]pyridin-2-yl)methyl 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
|---|---|
| PubChem CID | 135802889 |
| Molecular Formula | C18H15ClN4O4S |
| Molecular Weight | 418.86 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | (6-chloroimidazo[1,2-a]pyridin-2-yl)methyl 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
| SMILES | O=C(CC/N=C1\NS(=O)(=O)c2ccccc21)OCc1cn2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C18H15ClN4O4S/c19-12-5-6-16-21-13(10-23(16)9-12)11-27-17(24)7-8-20-18-14-3-1-2-4-15(14)28(25,26)22-18/h1-6,9-10H,7-8,11H2,(H,20,22) |
| InChIKey | HKHJBEBWLOHIKK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 102.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.86 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|