C21H18ClN3O5S — CID 135889394
(2-chloro-7-methoxyquinolin-3-yl)methyl 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate (PubChem CID 135889394) has the molecular formula C21H18ClN3O5S and a molecular weight of 459.91 g/mol. Its IUPAC name is (2-chloro-7-methoxyquinolin-3-yl)methyl 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate.
| Compound Name | (2-chloro-7-methoxyquinolin-3-yl)methyl 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
|---|---|
| PubChem CID | 135889394 |
| Molecular Formula | C21H18ClN3O5S |
| Molecular Weight | 459.91 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | (2-chloro-7-methoxyquinolin-3-yl)methyl 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
| SMILES | COc1ccc2cc(COC(=O)CC/N=C3\NS(=O)(=O)c4ccccc43)c(Cl)nc2c1 |
| InChI | InChI=1S/C21H18ClN3O5S/c1-29-15-7-6-13-10-14(20(22)24-17(13)11-15)12-30-19(26)8-9-23-21-16-4-2-3-5-18(16)31(27,28)25-21/h2-7,10-11H,8-9,12H2,1H3,(H,23,25) |
| InChIKey | DAKNANIOOAKIEX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.91 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|