C18H16BrFN2O4S — CID 135555681
(4-bromo-2-fluorophenyl)methyl 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate (PubChem CID 135555681) has the molecular formula C18H16BrFN2O4S and a molecular weight of 455.31 g/mol. Its IUPAC name is (4-bromo-2-fluorophenyl)methyl 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate.
| Compound Name | (4-bromo-2-fluorophenyl)methyl 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate |
|---|---|
| PubChem CID | 135555681 |
| Molecular Formula | C18H16BrFN2O4S |
| Molecular Weight | 455.31 g/mol |
| Exact Mass | 454.00 |
| IUPAC Name | (4-bromo-2-fluorophenyl)methyl 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate |
| SMILES | O=C(CCC/N=C1\NS(=O)(=O)c2ccccc21)OCc1ccc(Br)cc1F |
| InChI | InChI=1S/C18H16BrFN2O4S/c19-13-8-7-12(15(20)10-13)11-26-17(23)6-3-9-21-18-14-4-1-2-5-16(14)27(24,25)22-18/h1-2,4-5,7-8,10H,3,6,9,11H2,(H,21,22) |
| InChIKey | HKWRNXDSBNPQSY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|