C25H22N2O5S — CID 135920879
(2-oxo-1,2-diphenylethyl) 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate (PubChem CID 135920879) has the molecular formula C25H22N2O5S and a molecular weight of 462.53 g/mol. Its IUPAC name is (2-oxo-1,2-diphenylethyl) 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate.
| Compound Name | (2-oxo-1,2-diphenylethyl) 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate |
|---|---|
| PubChem CID | 135920879 |
| Molecular Formula | C25H22N2O5S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | (2-oxo-1,2-diphenylethyl) 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate |
| SMILES | O=C(CCC/N=C1\NS(=O)(=O)c2ccccc21)OC(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H22N2O5S/c28-22(16-9-17-26-25-20-14-7-8-15-21(20)33(30,31)27-25)32-24(19-12-5-2-6-13-19)23(29)18-10-3-1-4-11-18/h1-8,10-15,24H,9,16-17H2,(H,26,27) |
| InChIKey | QWMUCDAUTGPTMR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|