C18H17BrN2O4S — CID 135497499
4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butyl 2-bromobenzoate (PubChem CID 135497499) has the molecular formula C18H17BrN2O4S and a molecular weight of 437.32 g/mol. Its IUPAC name is 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butyl 2-bromobenzoate.
| Compound Name | 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butyl 2-bromobenzoate |
|---|---|
| PubChem CID | 135497499 |
| Molecular Formula | C18H17BrN2O4S |
| Molecular Weight | 437.32 g/mol |
| Exact Mass | 436.01 |
| IUPAC Name | 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butyl 2-bromobenzoate |
| SMILES | O=C(OCCCC/N=C1\NS(=O)(=O)c2ccccc21)c1ccccc1Br |
| InChI | InChI=1S/C18H17BrN2O4S/c19-15-9-3-1-7-13(15)18(22)25-12-6-5-11-20-17-14-8-2-4-10-16(14)26(23,24)21-17/h1-4,7-10H,5-6,11-12H2,(H,20,21) |
| InChIKey | ISUDLKGAQOUPSZ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|