C18H13ClN4O5S — CID 135914830
(7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetate (PubChem CID 135914830) has the molecular formula C18H13ClN4O5S and a molecular weight of 432.85 g/mol. Its IUPAC name is (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetate.
| Compound Name | (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetate |
|---|---|
| PubChem CID | 135914830 |
| Molecular Formula | C18H13ClN4O5S |
| Molecular Weight | 432.85 g/mol |
| Exact Mass | 432.03 |
| IUPAC Name | (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetate |
| SMILES | O=C(C/N=C1\NS(=O)(=O)c2ccccc21)OCc1cc(=O)n2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C18H13ClN4O5S/c19-11-5-6-15-21-12(7-16(24)23(15)9-11)10-28-17(25)8-20-18-13-3-1-2-4-14(13)29(26,27)22-18/h1-7,9H,8,10H2,(H,20,22) |
| InChIKey | BCGJILIVLABKAN-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 119.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.85 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|