C20H17FN4O5S — CID 135858352
[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate (PubChem CID 135858352) has the molecular formula C20H17FN4O5S and a molecular weight of 444.44 g/mol. Its IUPAC name is [3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate.
| Compound Name | [3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate |
|---|---|
| PubChem CID | 135858352 |
| Molecular Formula | C20H17FN4O5S |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | [3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate |
| SMILES | O=C(CCC/N=C1\NS(=O)(=O)c2ccccc21)OCc1nc(-c2ccc(F)cc2)no1 |
| InChI | InChI=1S/C20H17FN4O5S/c21-14-9-7-13(8-10-14)19-23-17(30-24-19)12-29-18(26)6-3-11-22-20-15-4-1-2-5-16(15)31(27,28)25-20/h1-2,4-5,7-10H,3,6,11-12H2,(H,22,25) |
| InChIKey | FBNPQLOYYCYDTP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 123.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|