C16H13F3N2O3S — CID 137268150
1,1-dioxo-N-[2-[2-(trifluoromethyl)phenoxy]ethyl]-1,2-benzothiazol-3-imine (PubChem CID 137268150) has the molecular formula C16H13F3N2O3S and a molecular weight of 370.35 g/mol. Its IUPAC name is 1,1-dioxo-N-[2-[2-(trifluoromethyl)phenoxy]ethyl]-1,2-benzothiazol-3-imine.
| Compound Name | 1,1-dioxo-N-[2-[2-(trifluoromethyl)phenoxy]ethyl]-1,2-benzothiazol-3-imine |
|---|---|
| PubChem CID | 137268150 |
| Molecular Formula | C16H13F3N2O3S |
| Molecular Weight | 370.35 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 1,1-dioxo-N-[2-[2-(trifluoromethyl)phenoxy]ethyl]-1,2-benzothiazol-3-imine |
| SMILES | O=S1(=O)N/C(=N\CCOc2ccccc2C(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C16H13F3N2O3S/c17-16(18,19)12-6-2-3-7-13(12)24-10-9-20-15-11-5-1-4-8-14(11)25(22,23)21-15/h1-8H,9-10H2,(H,20,21) |
| InChIKey | BPXWJVITRCBMTF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|