C10H10F2N2O3S — CID 136794774
3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1,1-difluoropropan-2-ol (PubChem CID 136794774) has the molecular formula C10H10F2N2O3S and a molecular weight of 276.26 g/mol. Its IUPAC name is 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1,1-difluoropropan-2-ol.
| Compound Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1,1-difluoropropan-2-ol |
|---|---|
| PubChem CID | 136794774 |
| Molecular Formula | C10H10F2N2O3S |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1,1-difluoropropan-2-ol |
| SMILES | O=S1(=O)N/C(=N\CC(O)C(F)F)c2ccccc21 |
| InChI | InChI=1S/C10H10F2N2O3S/c11-9(12)7(15)5-13-10-6-3-1-2-4-8(6)18(16,17)14-10/h1-4,7,9,15H,5H2,(H,13,14) |
| InChIKey | IUBUGYOIDNROJN-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|