C19H22N2O6S — CID 11894439
[(3S,4R)-4-(methoxycarbonylamino)thiolan-3-yl] (2R)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate (PubChem CID 11894439) has the molecular formula C19H22N2O6S and a molecular weight of 406.46 g/mol. Its IUPAC name is [(3S,4R)-4-(methoxycarbonylamino)thiolan-3-yl] (2R)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate.
| Compound Name | [(3S,4R)-4-(methoxycarbonylamino)thiolan-3-yl] (2R)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate |
|---|---|
| PubChem CID | 11894439 |
| Molecular Formula | C19H22N2O6S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | [(3S,4R)-4-(methoxycarbonylamino)thiolan-3-yl] (2R)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate |
| SMILES | COC(=O)N[C@H]1CSC[C@H]1OC(=O)[C@@H](C(C)C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H22N2O6S/c1-10(2)15(21-16(22)11-6-4-5-7-12(11)17(21)23)18(24)27-14-9-28-8-13(14)20-19(25)26-3/h4-7,10,13-15H,8-9H2,1-3H3,(H,20,25)/t13-,14+,15+/m0/s1 |
| InChIKey | YAJXRJGSGUCCOB-RRFJBIMHSA-N |
| XLogP | 1.69 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|