C18H23N3O3 — CID 119427532
2-(1,3-dioxoisoindol-2-yl)-3-methyl-N-piperidin-3-ylbutanamide (PubChem CID 119427532) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-3-methyl-N-piperidin-3-ylbutanamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-3-methyl-N-piperidin-3-ylbutanamide |
|---|---|
| PubChem CID | 119427532 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-3-methyl-N-piperidin-3-ylbutanamide |
| SMILES | CC(C)C(C(=O)NC1CCCNC1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H23N3O3/c1-11(2)15(16(22)20-12-6-5-9-19-10-12)21-17(23)13-7-3-4-8-14(13)18(21)24/h3-4,7-8,11-12,15,19H,5-6,9-10H2,1-2H3,(H,20,22) |
| InChIKey | HWPLEXXSPZSDTH-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|