C21H30ClN3O3 — CID 119591097
N-(2-amino-1-cyclohexylethyl)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide;hydrochloride (PubChem CID 119591097) has the molecular formula C21H30ClN3O3 and a molecular weight of 407.94 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexylethyl)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide;hydrochloride.
| Compound Name | N-(2-amino-1-cyclohexylethyl)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119591097 |
| Molecular Formula | C21H30ClN3O3 |
| Molecular Weight | 407.94 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | N-(2-amino-1-cyclohexylethyl)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide;hydrochloride |
| SMILES | CC(C)C(C(=O)NC(CN)C1CCCCC1)N1C(=O)c2ccccc2C1=O.Cl |
| InChI | InChI=1S/C21H29N3O3.ClH/c1-13(2)18(19(25)23-17(12-22)14-8-4-3-5-9-14)24-20(26)15-10-6-7-11-16(15)21(24)27;/h6-7,10-11,13-14,17-18H,3-5,8-9,12,22H2,1-2H3,(H,23,25);1H |
| InChIKey | KLEUPFQORUBXMY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.94 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|