C20H27N3O3 — CID 119590379
N-(2-amino-1-cyclohexylethyl)-2-(5-methyl-1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 119590379) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexylethyl)-2-(5-methyl-1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-(2-amino-1-cyclohexylethyl)-2-(5-methyl-1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 119590379 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | N-(2-amino-1-cyclohexylethyl)-2-(5-methyl-1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | Cc1ccc2c(c1)C(=O)N(C(C)C(=O)NC(CN)C1CCCCC1)C2=O |
| InChI | InChI=1S/C20H27N3O3/c1-12-8-9-15-16(10-12)20(26)23(19(15)25)13(2)18(24)22-17(11-21)14-6-4-3-5-7-14/h8-10,13-14,17H,3-7,11,21H2,1-2H3,(H,22,24) |
| InChIKey | SPDWQDCVDWJMDF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|