C19H25N3O3 — CID 119594509
2-[1-[3-(1-aminoethyl)piperidin-1-yl]-1-oxopropan-2-yl]-5-methylisoindole-1,3-dione (PubChem CID 119594509) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is 2-[1-[3-(1-aminoethyl)piperidin-1-yl]-1-oxopropan-2-yl]-5-methylisoindole-1,3-dione.
| Compound Name | 2-[1-[3-(1-aminoethyl)piperidin-1-yl]-1-oxopropan-2-yl]-5-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 119594509 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 2-[1-[3-(1-aminoethyl)piperidin-1-yl]-1-oxopropan-2-yl]-5-methylisoindole-1,3-dione |
| SMILES | Cc1ccc2c(c1)C(=O)N(C(C)C(=O)N1CCCC(C(C)N)C1)C2=O |
| InChI | InChI=1S/C19H25N3O3/c1-11-6-7-15-16(9-11)19(25)22(18(15)24)13(3)17(23)21-8-4-5-14(10-21)12(2)20/h6-7,9,12-14H,4-5,8,10,20H2,1-3H3 |
| InChIKey | WOAWDRSKRFVPDB-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|