C21H26N2O5 — CID 46630082
[1-(azepan-1-yl)-1-oxopropan-2-yl] 2-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 46630082) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is [1-(azepan-1-yl)-1-oxopropan-2-yl] 2-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [1-(azepan-1-yl)-1-oxopropan-2-yl] 2-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 46630082 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | [1-(azepan-1-yl)-1-oxopropan-2-yl] 2-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | Cc1ccc2c(c1)C(=O)N(C(C)C(=O)OC(C)C(=O)N1CCCCCC1)C2=O |
| InChI | InChI=1S/C21H26N2O5/c1-13-8-9-16-17(12-13)20(26)23(19(16)25)14(2)21(27)28-15(3)18(24)22-10-6-4-5-7-11-22/h8-9,12,14-15H,4-7,10-11H2,1-3H3 |
| InChIKey | LZBHDMGWZVOWCE-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|