C18H23ClN2O — CID 119428640
2-naphthalen-2-yl-N-piperidin-3-ylpropanamide;hydrochloride (PubChem CID 119428640) has the molecular formula C18H23ClN2O and a molecular weight of 318.85 g/mol. Its IUPAC name is 2-naphthalen-2-yl-N-piperidin-3-ylpropanamide;hydrochloride.
| Compound Name | 2-naphthalen-2-yl-N-piperidin-3-ylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 119428640 |
| Molecular Formula | C18H23ClN2O |
| Molecular Weight | 318.85 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 2-naphthalen-2-yl-N-piperidin-3-ylpropanamide;hydrochloride |
| SMILES | CC(C(=O)NC1CCCNC1)c1ccc2ccccc2c1.Cl |
| InChI | InChI=1S/C18H22N2O.ClH/c1-13(18(21)20-17-7-4-10-19-12-17)15-9-8-14-5-2-3-6-16(14)11-15;/h2-3,5-6,8-9,11,13,17,19H,4,7,10,12H2,1H3,(H,20,21);1H |
| InChIKey | UOHIGUDHDSXZFB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.85 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |