C27H21N3O7 — CID 55465425
[2-[2-(methylcarbamoyl)-2,3-dihydro-1,4-benzoxazin-4-yl]-2-oxoethyl] 3-(1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 55465425) has the molecular formula C27H21N3O7 and a molecular weight of 499.48 g/mol. Its IUPAC name is [2-[2-(methylcarbamoyl)-2,3-dihydro-1,4-benzoxazin-4-yl]-2-oxoethyl] 3-(1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | [2-[2-(methylcarbamoyl)-2,3-dihydro-1,4-benzoxazin-4-yl]-2-oxoethyl] 3-(1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 55465425 |
| Molecular Formula | C27H21N3O7 |
| Molecular Weight | 499.48 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | [2-[2-(methylcarbamoyl)-2,3-dihydro-1,4-benzoxazin-4-yl]-2-oxoethyl] 3-(1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | CNC(=O)C1CN(C(=O)COC(=O)c2cccc(N3C(=O)c4ccccc4C3=O)c2)c2ccccc2O1 |
| InChI | InChI=1S/C27H21N3O7/c1-28-24(32)22-14-29(20-11-4-5-12-21(20)37-22)23(31)15-36-27(35)16-7-6-8-17(13-16)30-25(33)18-9-2-3-10-19(18)26(30)34/h2-13,22H,14-15H2,1H3,(H,28,32) |
| InChIKey | FJZCEYJYFZRWLL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.48 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|