C23H18N4O5 — CID 55306268
[2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 3-(1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 55306268) has the molecular formula C23H18N4O5 and a molecular weight of 430.42 g/mol. Its IUPAC name is [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 3-(1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 3-(1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 55306268 |
| Molecular Formula | C23H18N4O5 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 3-(1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | N#CCCN(CCC#N)C(=O)COC(=O)c1cccc(N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C23H18N4O5/c24-10-4-12-26(13-5-11-25)20(28)15-32-23(31)16-6-3-7-17(14-16)27-21(29)18-8-1-2-9-19(18)22(27)30/h1-3,6-9,14H,4-5,12-13,15H2 |
| InChIKey | CJSXIUZMMKVCRW-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 131.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|